|
|
| | 3-Hydroxy-2-methyl-4-quinolinecarboxylic acid Basic information |
| | 3-Hydroxy-2-methyl-4-quinolinecarboxylic acid Chemical Properties |
| Melting point | 235 °C (dec.) (lit.) | | Boiling point | 341.49°C (rough estimate) | | density | 1.2621 (rough estimate) | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.4950 (estimate) | | Fp | 252 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | 0.04 g/L (20°C) | | pka | 0.74±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | Water Solubility | 0.04 g/L (20 ºC) | | InChI | InChI=1S/C11H9NO3/c1-6-10(13)9(11(14)15)7-4-2-3-5-8(7)12-6/h2-5,13H,1H3,(H,14,15) | | InChIKey | RVGATDHHYVSTQG-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C(C(O)=O)=C(O)C=1C | | LogP | 2.9 | | CAS DataBase Reference | 117-57-7(CAS DataBase Reference) | | EPA Substance Registry System | 4-Quinolinecarboxylic acid, 3-hydroxy-2-methyl- (117-57-7) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39-36/37/39-22 | | WGK Germany | 1 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Hydroxy-2-methyl-4-quinolinecarboxylic acid Usage And Synthesis |
| Chemical Properties | yellow to greenish powder | | Uses | 3-Hydroxy-2-methyl-4-quinolinecarboxylic acid may be used in chemical synthesis studies. | | Flammability and Explosibility | Not classified |
| | 3-Hydroxy-2-methyl-4-quinolinecarboxylic acid Preparation Products And Raw materials |
|