|
|
| | 4,4'-DIMETHOXYBENZHYDRYLAMINE Basic information |
| | 4,4'-DIMETHOXYBENZHYDRYLAMINE Chemical Properties |
| Melting point | 62°C | | Boiling point | 391.9±42.0 °C(Predicted) | | density | 1.099±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 8.85±0.10(Predicted) | | color | White to Almost white | | InChI | 1S/C15H17NO2/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15H,16H2,1-2H3 | | InChIKey | HROGQYMZWGPHIB-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1)C(N)c2ccc(OC)cc2 |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-50 | | Safety Statements | 26-36/37/39-61 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2922290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | 4,4'-DIMETHOXYBENZHYDRYLAMINE Usage And Synthesis |
| | 4,4'-DIMETHOXYBENZHYDRYLAMINE Preparation Products And Raw materials |
|