|
|
| | Bis-(4-methoxy-benzyl)-amine Basic information |
| Product Name: | Bis-(4-methoxy-benzyl)-amine | | Synonyms: | CHEMBRDG-BB 5550428;N,N-bis(4-methoxybenzyl)amine;BenzeneMethanaMine, 4-Methoxy-N-[(4-Methoxyphenyl)Methyl]-;Bis(4-methoxybenzyl);Bis(4-methoxybenzyl)amine,97%;N-Bis(4-methoxybenzyl)amine;BIS-(4-METHOXY-BENZYL)-AMINE ISO 9001:2015 REACH;BI5-(4-M ETHOXY-BENZYL)-AMI NE | | CAS: | 17061-62-0 | | MF: | C16H19NO2 | | MW: | 257.33 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | Mol File |  |
| | Bis-(4-methoxy-benzyl)-amine Chemical Properties |
| Melting point | 35-37℃ | | Boiling point | 384℃ | | density | 1.073 | | Fp | 161℃ | | storage temp. | 2-8°C(protect from light) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.55±0.20(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C16H19NO2/c1-18-15-7-3-13(4-8-15)11-17-12-14-5-9-16(19-2)10-6-14/h3-10,17H,11-12H2,1-2H3 | | InChIKey | HBKPDEWGANZHJO-UHFFFAOYSA-N | | SMILES | C1(CNCC2=CC=C(OC)C=C2)=CC=C(OC)C=C1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HazardClass | 8 | | HS Code | 2922190090 |
| | Bis-(4-methoxy-benzyl)-amine Usage And Synthesis |
| Uses | N,N-Bis(4-methoxybenzyl)amine acts as a reagent for the synthesis and biological evaluation of pentanedioc acid derivatives as farnesyltransferase inhibitors. Also used in the preparation of (heteroarylamino)triazolamines as antiviral agents useful in the treatment of HCV infection. | | Definition | ChEBI: N,N-di(4-methoxybenzyl)amine is an aromatic amine. | | Synthesis | Bis-(4-methoxybenzyl)-amines can be prepared from 4-methoxybenzaldehyde and 4-methoxybenzylamine by reductive amination. |
| | Bis-(4-methoxy-benzyl)-amine Preparation Products And Raw materials |
|