| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | 4-Amino-5-bromo-2-chloropyridine Basic information |
| Product Name: | 4-Amino-5-bromo-2-chloropyridine | | Synonyms: | 2-CHLORO-5-BROMO-PYRIDINE-4-YLAMINE;5-Bromo-2-chloro-4-pyridinamine;2-Chloro-5-bromo-4-aminopyridine;111548;4-Pyridinamine, 5-bromo-2-chloro-;4-AMINO-5-BROMO-2-CHLOROPYRIDINE ISO 9001：2015 REACH;2-Chloro-4-amino-5-bromopyridine;4-Amino-5-bromo-2-chloropyridine, 95%, | | CAS: | 857730-21-3 | | MF: | C5H4BrClN2 | | MW: | 207.46 | | EINECS: | | | Product Categories: | | | Mol File: | 857730-21-3.mol |  |
| | 4-Amino-5-bromo-2-chloropyridine Chemical Properties |
| Melting point | 127.3-128.4 °C | | Boiling point | 315.5±37.0 °C(Predicted) | | density | 1.834±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.73±0.42(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C5H4BrClN2/c6-3-2-9-5(7)1-4(3)8/h1-2H,(H2,8,9) | | InChIKey | MGZWZNBANVSZLM-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(Br)C(N)=C1 |
| Hazard Codes | T | | Risk Statements | 25-37/38-41 | | Safety Statements | 26-39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| | 4-Amino-5-bromo-2-chloropyridine Usage And Synthesis |
| Uses | 4-Amino-5-bromo-2-chloropyridine is a pyridine analogue of a halogenated element. It can be used in organic synthesis or as a reaction reagent, and can also be used in the preparation of kinase inhibitors. |
| | 4-Amino-5-bromo-2-chloropyridine Preparation Products And Raw materials |
|