|
|
| | 4-Ethynyl-benzoic acid methyl ester Basic information | | Synthesis |
| Product Name: | 4-Ethynyl-benzoic acid methyl ester | | Synonyms: | 4-(Methoxycarbonyl)phenylacetylene;Methyl-4-Ethylnylbenzoate;Methyl p-ethynylbenzoate;p-Ethynylbenzoic acid methyl ester;Benzoic acid,4-ethynyl-, Methyl ester;Methyl 4-ethynylbenzoate 95%;EOS-62181;DK7409 | | CAS: | 3034-86-4 | | MF: | C10H8O2 | | MW: | 160.17 | | EINECS: | | | Product Categories: | | | Mol File: | 3034-86-4.mol |  |
| | 4-Ethynyl-benzoic acid methyl ester Chemical Properties |
| Melting point | 103-105℃ | | Boiling point | 239.4±23.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Orange to Green | | Water Solubility | Sparingly soluble in water (0.16 g/L at 25°C). | | λmax | 258nm(EtOH)(lit.) | | InChI | InChI=1S/C10H8O2/c1-3-8-4-6-9(7-5-8)10(11)12-2/h1,4-7H,2H3 | | InChIKey | JPGRSTBIEYGVNO-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(C#C)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Ethynyl-benzoic acid methyl ester Usage And Synthesis |
| Synthesis | 3-(4-(methoxycarbonyl)phenyl)propanoic acid (204 mg, 1.0 mmol) and N,N,N',N'-tetramethylethylenediamine (2.0 mmol) were added to a vacuum-dried reaction flask and reacted in dimethyl sulfoxide (3.0 mL) at 65 °C for 12 hours. The reaction progress was monitored by TLC. After the reactants had completely reacted, the reaction was quenched with saturated ammonium chloride aqueous solution. The mixture was diluted with ethyl acetate and washed with saturated sodium chloride (20 mL x 2). The organic layer was separated and dried with anhydrous magnesium sulfate. The reaction mixture was filtered to remove sodium sulfate solids. The obtained organic layer was concentrated under vacuum to remove the solvent, yielding a crude product. The residue was purified by silica gel column chromatography (eluent: hexane/ethyl acetate = 40/1) to obtain the target product, 4-ETHYNYL-BENZOIC ACID METHYL ESTER. Figure 1. Synthetic route of 4-ETHYNYL-BENZOIC ACID METHYL ESTER. | | Uses | Methyl 4-ethynylbenzoate is used as pharmaceutical intermediate. |
| | 4-Ethynyl-benzoic acid methyl ester Preparation Products And Raw materials |
|