METHYL 4-VINYLBENZOATE manufacturers
|
| | METHYL 4-VINYLBENZOATE Basic information |
| | METHYL 4-VINYLBENZOATE Chemical Properties |
| Melting point | 32-36 °C(lit.) | | Boiling point | 89-90℃ (2 Torr) | | density | 1.058±0.06 g/cm3(Predicted) | | refractive index | 1.5568 (589.3 nm 25℃) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | crystals | | color | White | | InChI | InChI=1S/C10H10O2/c1-3-8-4-6-9(7-5-8)10(11)12-2/h3-7H,1H2,2H3 | | InChIKey | NUMHUJZXKZKUBN-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(C=C)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2916399090 |
| | METHYL 4-VINYLBENZOATE Usage And Synthesis |
| Uses | Methyl 4-vinylbenzoate is used as a fluid component for enhancing ink stability in printing and also in preparing vinyl substituted beta-diketones. Further, it is used as an organic intermediate for pharmaceuticals. |
| | METHYL 4-VINYLBENZOATE Preparation Products And Raw materials |
| Raw materials | Hexane, 1-(ethenylsulfinyl)-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro--->Ethene, [(trifluoromethyl)sulfinyl]--->4-ETHYNYL-BENZOIC ACID METHYL ESTER-->4-Vinylbenzoic acid-->5,5-dimethyl-2-(4-ethenylphenyl)-1,3,2-dioxaborinane-->4-VINYL-BENZALDEHYDE-->Tributyl(vinyl)tin-->Methyl 4-iodobenzoate-->Methanol-->Di-tert-butyl dicarbonate-->Methyl 4-formylbenzoate-->Methyl 4-bromobenzoate |
|