|
|
| | IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE Basic information |
| Product Name: | IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE | | Synonyms: | IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE;Imidazo[1,2-a]pyrazine-3-carboxaldehyde (9CI);Imidazo[1,2-a]pyrazine-3-carboxaldehyde;3-imidazo[1,2-a]pyrazinecarboxaldehyde;IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE ISO 9001:2015 REACH;Imidazo[1,2-a]pyrazine-3-carboxaldehyde - [AC77561] | | CAS: | 106012-58-2 | | MF: | C7H5N3O | | MW: | 147.13 | | EINECS: | | | Product Categories: | ALDEHYDE | | Mol File: | 106012-58-2.mol | ![IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE Structure](CAS/GIF/106012-58-2.gif) |
| | IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE Chemical Properties |
| density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 1.65±0.30(Predicted) | | InChI | InChI=1S/C7H5N3O/c11-5-6-3-9-7-4-8-1-2-10(6)7/h1-5H | | InChIKey | FTYAMGYSJHEZQA-UHFFFAOYSA-N | | SMILES | C12=NC=C(C=O)N1C=CN=C2 |
| | IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE Usage And Synthesis |
| | IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE Preparation Products And Raw materials |
|