| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl 2-amino-5-bromo-4-pyridinecarboxylate Basic information |
| Product Name: | Methyl 2-amino-5-bromo-4-pyridinecarboxylate | | Synonyms: | METHYL 2-AMINO-5-BROMO-4-PYRIDINECARBOXYLATE;METHYL 2-AMINO-5-BROMOPYRIDINE-4-CARBOXYLATE;Methyl 2-amino-5-bromoisonicotinate 98%;Methyltinate 2-amino-5-bromoisonico;Methyl 2-amino-5-bromopyridine-4-carboxylate, 2-Amino-5-bromo-4-(methoxycarbonyl)pyridine;2-AMino-5-broMoisonicotinic acid Methyl ester;4-Pyridinecarboxylic acid, 2-aMino-5-broMo-, Methyl ester;Methyl 2-aMMino-5-broMoisonicotinate | | CAS: | 882499-87-8 | | MF: | C7H7BrN2O2 | | MW: | 231.05 | | EINECS: | 663-515-5 | | Product Categories: | blocks;Bromides;Carboxes;Pyridines | | Mol File: | 882499-87-8.mol |  |
| | Methyl 2-amino-5-bromo-4-pyridinecarboxylate Chemical Properties |
| Boiling point | 311.5±37.0 °C(Predicted) | | density | 1.662±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 2.78±0.24(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H7BrN2O2/c1-12-7(11)4-2-6(9)10-3-5(4)8/h2-3H,1H3,(H2,9,10) | | InChIKey | FJPDYKLTAURVRU-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(Br)C(C(OC)=O)=C1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | Methyl 2-amino-5-bromo-4-pyridinecarboxylate Usage And Synthesis |
| Uses | Methyl 2-amino-5-bromo-4-pyridinecarboxylate is a halogenated derivative of pyridinecarboxylate. It is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
| | Synthesis | Step 15.1: Synthesis of methyl 2-amino-5-bromoisonicotinate. Methyl 2-aminoisonicotinate (5.58 g, 36.7 mmol) was dissolved in DMF (56 mL) and cooled to -18°C (using an ice/MeOH bath). At -18 °C, N-bromosuccinimide (NBS, 7.21 g, 38.5 mmol) was added to the reaction mixture in batches and stirred for 1 h at the same temperature. After completion of the reaction, the mixture was diluted with ethyl acetate (AcOEt, 500 mL) and washed with water (2 x 250 mL). The organic layer was dried over anhydrous sodium sulfate (Na2SO4), filtered and concentrated under reduced pressure to give the crude product methyl 2-amino-5-bromoisonicotinate (3.0 g, 13.0 mmol, 35% yield) as a yellow solid, which was used directly in the next reaction without further purification. Mass spectrometry (MS): m/z 231 [M + H]+; high performance liquid chromatography (HPLC): retention time (Rt) = 0.70 min. | | References | [1] Patent: WO2007/113226, 2007, A1. Location in patent: Page/Page column 126-127
[2] Patent: US2006/84802, 2006, A1. Location in patent: Page/Page column 29 |
| | Methyl 2-amino-5-bromo-4-pyridinecarboxylate Preparation Products And Raw materials |
|