2-ethylhexanoic acid, molybdenum salt manufacturers
|
| | 2-ethylhexanoic acid, molybdenum salt Basic information |
| Product Name: | 2-ethylhexanoic acid, molybdenum salt | | Synonyms: | 2-Ethylhexanoic acid/molybdenum,(1:x) salt;2-ethylhexanoic acid, molybdenum salt;2-ethyl-hexanoic aci molybdenum salt;MOLYBDENUM(IV)2-ETHYLHEXANOATE(15%MO);Hexanoic acid, 2-ethyl-, molybdenum salt;Hexanoic acid,2-ethyl-,molybdenum salt;Molybdenum(IV) 2-ethylhexanoate Liquid;Hexanoic acid, 2-ethyl-, molybdenum salt (1:) | | CAS: | 34041-09-3 | | MF: | C8H16MoO2 | | MW: | 240.16 | | EINECS: | 251-807-1 | | Product Categories: | Organic-metal salt;metal carboxylate | | Mol File: | 34041-09-3.mol |  |
| | 2-ethylhexanoic acid, molybdenum salt Chemical Properties |
| Boiling point | 250℃[at 101 325 Pa] | | density | 1.11-1.15 | | vapor pressure | 0-4Pa at 20℃ | | Fp | 250°F | | form | liquid | | color | reddish-brown | | Specific Gravity | 1.11～1.15 | | Water Solubility | 21.95-1000mg/L at 20℃ | | InChI | InChI=1S/C8H16O2.Mo/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10); | | InChIKey | VXIWJTFRRIZCQJ-UHFFFAOYSA-N | | SMILES | C(CC)(C(=O)O)CCCC.[Mo] | | LogP | 2.7 at 25℃ | | EPA Substance Registry System | Molybdenum 2-ethylhexanoate (34041-09-3) |
| | 2-ethylhexanoic acid, molybdenum salt Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | 2-ethylhexanoic acid, molybdenum salt Preparation Products And Raw materials |
|