- OCTAETHYLENE GLYCOL
-
-
2026-08-08
- CAS:5117-19-1
- Min. Order: 1kg
- Purity: 99.0%min
- Supply Ability: 10000kg
- Octaethylene glycol
-
-
2026-07-24
- CAS:5117-19-1
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | Octaethylene glycol Basic information |
| | Octaethylene glycol Chemical Properties |
| Melting point | 22 °C | | Boiling point | 175 °C(Press: 0.01 Torr) | | density | 1.13 | | refractive index | 1.4640-1.4680 | | storage temp. | -20°C | | pka | 14.06±0.10(Predicted) | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | Cosmetics Ingredients Functions | SOLVENT HUMECTANT | | InChI | InChI=1S/C16H34O9/c17-1-3-19-5-7-21-9-11-23-13-15-25-16-14-24-12-10-22-8-6-20-4-2-18/h17-18H,1-16H2 | | InChIKey | GLZWNFNQMJAZGY-UHFFFAOYSA-N | | SMILES | C(O)COCCOCCOCCOCCOCCOCCOCCO | | CAS DataBase Reference | 5117-19-1(CAS DataBase Reference) | | EPA Substance Registry System | Octaethylene glycol (5117-19-1) |
| WGK Germany | 3 | | HS Code | 2909498090 | | Storage Class | 10 - Combustible liquids |
| | Octaethylene glycol Usage And Synthesis |
| Description | Octanethylene glycol is a polymer consisting of ethylene glycol monomers and two terminal hydroxyl groups. The PEG chain increases the water solubility of a compound in aqueous media. Increasing the number of ethylene glycol units within the entire chain improves the solubility properties of the PEG linker. | | Uses | Octaethylene Glycol is part of a leaf extract (Murdannia Bracteata) which was shown to exhibit antioxidant, antimicrobial and anti-cancer properties.Octaethylene Glycol also shows potential application as functional hydraulic fluids. | | Uses | Applications may include: bioconjugation, drug delivery, PEG hydrogel, crosslinker, and surface functionalization | | Definition | ChEBI: Octaethylene glycol is a poly(ethylene glycol). | | reaction suitability | reagent type: cross-linking reagent | | IC 50 | PEGs |
| | Octaethylene glycol Preparation Products And Raw materials |
|