|
|
| | 3,3'-(1,4-Phenylenedi-2,1-ethenediyl)bis(9-ethyl-9H-carbazole) Basic information |
| Product Name: | 3,3'-(1,4-Phenylenedi-2,1-ethenediyl)bis(9-ethyl-9H-carbazole) | | Synonyms: | BCzVB;1,4-Bis(9-ethyl-3-carbazovinylene)benzene;1,4-Bis[2-(3-N-ethylcarbazoryl)vinyl]benzene;3,3'-(1,4-Phenylened;BCzVB , 3,3'-(1,4-Phenylenedi-2,1-ethenediyl)bis(9-ethyl;3,3'-(1,4-Phenylenedi-2,1-ethenediyl)bis(9-ethyl-9H-carbazole);BCZVB, 1,4-bis[2-(3-N-ethylcarbazoryl)vinyl]benzene;1,4-Bis[2-(9-ethylcarbazol-3-yl)vinyl]benzene | | CAS: | 62608-15-5 | | MF: | C38H32N2 | | MW: | 516.68 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 62608-15-5.mol |  |
| | 3,3'-(1,4-Phenylenedi-2,1-ethenediyl)bis(9-ethyl-9H-carbazole) Chemical Properties |
| Boiling point | 744.9±60.0 °C(Predicted) | | density | 1.11 | | form | powder to crystal | | color | White to Yellow to Green | | λmax | 330nm(DMF)(lit.) | | InChIKey | JQXNAJZMEBHUMC-XPWSMXQVSA-N | | SMILES | CCN1C2=C(C=CC=C2)C3=C1C=CC(/C=C/C4=CC=C(/C=C/C5=CC(C(C=CC=C6)=C6N7CC)=C7C=C5)C=C4)=C3 |
| WGK Germany | WGK 3 | | HS Code | 2933.99.8290 | | Storage Class | 11 - Combustible Solids |
| | 3,3'-(1,4-Phenylenedi-2,1-ethenediyl)bis(9-ethyl-9H-carbazole) Usage And Synthesis |
| Uses | Blue-emitting material for full color displays. It may be used as a blue emitter for a double emitting layer in white organic light emitting diodes (WOLEDs). |
| | 3,3'-(1,4-Phenylenedi-2,1-ethenediyl)bis(9-ethyl-9H-carbazole) Preparation Products And Raw materials |
|