|
|
| | 2-(2-Aminothiazol-4-yl) acetic acid hydrochloride Basic information |
| | 2-(2-Aminothiazol-4-yl) acetic acid hydrochloride Chemical Properties |
| Melting point | 152°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C5H6N2O2S.ClH/c6-5-7-3(2-10-5)1-4(8)9;/h2H,1H2,(H2,6,7)(H,8,9);1H | | InChIKey | ZEWJJZKVQOMYKJ-UHFFFAOYSA-N | | SMILES | C(C1=CSC(N)=N1)C(=O)O.Cl | | CAS DataBase Reference | 66659-20-9(CAS DataBase Reference) |
| | 2-(2-Aminothiazol-4-yl) acetic acid hydrochloride Usage And Synthesis |
| Uses | 2-(2-Aminothiazol-4-yl)acetic Acid-13C, 15N2 Hydrochloride is an intermediate used in the synthesis of Cefotiam Dihydrochloride-13C, 15N2 (C243007), which is labelled Cefotiam Dihydrochloride (C243005), which is an antibiotic product used in injections to treat bacterial infections. Cefotiam Dihydrochloride can also reduce allergic reactions and mixed with pharmaceutical carriers for medical formulations. |
| | 2-(2-Aminothiazol-4-yl) acetic acid hydrochloride Preparation Products And Raw materials |
|