|
|
| | 3,5-DIMETHYL-4H-1,2,4-TRIAZOLE Basic information |
| Product Name: | 3,5-DIMETHYL-4H-1,2,4-TRIAZOLE | | Synonyms: | 3,5-DIMETHYL-4H-1,2,4-TRIAZOLE;3,5-DIMETHYL-1,2,4-TRIAZOLE;3,5-Dimethyl-1,2,4-triazo...;3,5-dimethyl-4H-1,2,4-triazole(SALTDATA: FREE);1H-1,2,4-triazole, 3,5-dimethyl-;3,5-Dimethyl-1H-1,2,4-triazole;112227;3,5-Dimethyl-1,2,4-triazole > | | CAS: | 7343-34-2 | | MF: | C4H7N3 | | MW: | 97.12 | | EINECS: | | | Product Categories: | | | Mol File: | 7343-34-2.mol |  |
| | 3,5-DIMETHYL-4H-1,2,4-TRIAZOLE Chemical Properties |
| Melting point | 139.0 to 144.0 °C | | Boiling point | 260°C(lit.) | | density | 1.6446 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | solid | | pka | 11.02±0.40(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C4H7N3/c1-3-5-4(2)7-6-3/h1-2H3,(H,5,6,7) | | InChIKey | XYYXDARQOHWBPO-UHFFFAOYSA-N | | SMILES | N1C(C)=NC(C)=N1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 3,5-DIMETHYL-4H-1,2,4-TRIAZOLE Usage And Synthesis |
| Chemical Properties | White crystal | | Uses | 3,5-Dimethyl-4H-1,2,4-triazole is an organic building block that can be used as a ligand. It can be employed in photochemical reactions with [M(CO)₆] (M = chromium, molybdenum, and tungsten) to prepare metal complexes. These complexes are stable in the solid state at low temperatures. In solution, the tungsten compound may also be handled in air, but the chromium and molybdenum compounds are slightly sensitive to air in solution. These compounds are soluble in polar solvents such as acetone and chlorinated solvents. |
| | 3,5-DIMETHYL-4H-1,2,4-TRIAZOLE Preparation Products And Raw materials |
|