| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chloro-4,6-dinitroaniline Basic information |
| | 2-Chloro-4,6-dinitroaniline Chemical Properties |
| Melting point | 157-159 °C(lit.) | | Boiling point | 280°C (rough estimate) | | density | 2.0410 (rough estimate) | | refractive index | 1.6000 (estimate) | | pka | -6.83±0.10(Predicted) | | form | powder | | InChI | InChI=1S/C6H4ClN3O4/c7-4-1-3(9(11)12)2-5(6(4)8)10(13)14/h1-2H,8H2 | | InChIKey | LHRIICYSGQGXSX-UHFFFAOYSA-N | | SMILES | C1(N)=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1Cl | | CAS DataBase Reference | 3531-19-9(CAS DataBase Reference) | | EPA Substance Registry System | 2-Chloro-4,6-dinitroaniline (3531-19-9) |
| Hazard Codes | Xn,N,T+ | | Risk Statements | 20/21/22-36/37/38-51/53-33-26/27/28 | | Safety Statements | 26-28-36/37/39-45-61-36/37 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | BX9250000 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |
| | 2-Chloro-4,6-dinitroaniline Usage And Synthesis |
| Chemical Properties | yellow crystalline powder and/or chunks | | Uses | 6-Chloro-2,4-dinitroaniline is a useful aromatic building block, and has aquatic toxicity properties. | | General Description | 6-chloro-2,4-dinitroaniline exists in three polymorphic forms which can be separated on the basis of their mechanical properties. |
| | 2-Chloro-4,6-dinitroaniline Preparation Products And Raw materials |
|