- Tretazicar
-
- $47.00
-
2026-04-20
- CAS:21919-05-1
- Purity: 99.41%
- Supply Ability: 10g
|
| | 5-Aziridino-2,4-dinitrobenzamide Basic information |
| Product Name: | 5-Aziridino-2,4-dinitrobenzamide | | Synonyms: | CB 1954;CB-1954;5-(1-aziridinyl)-2,4-dinitrobenzamide;NSC 115829;tretazicar;5-(1-Aziridinyl)-2,4-dinitrobenzamide, 5-(Aziridin-1-yl)-2,4-dinitrobenzamide;5-Aziridino-2,4-dinitrobenzamide;2,4-Dinitro-5-(aziridine-1-yl)benzamide;CB-954 | | CAS: | 21919-05-1 | | MF: | C9H8N4O5 | | MW: | 252.18 | | EINECS: | | | Product Categories: | | | Mol File: | 21919-05-1.mol |  |
| | 5-Aziridino-2,4-dinitrobenzamide Chemical Properties |
| Melting point | 173 °C | | Boiling point | 427.2±45.0 °C(Predicted) | | density | 1.671±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Acetonitrile (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 14.23±0.50(Predicted) | | form | solid | | color | Yellow to Dark Yellow | | InChI | 1S/C9H8N4O5/c10-9(14)5-3-7(11-1-2-11)8(13(17)18)4-6(5)12(15)16/h3-4H,1-2H2,(H2,10,14) | | InChIKey | WOCXQMCIOTUMJV-UHFFFAOYSA-N | | SMILES | NC(=O)c1cc(N2CC2)c(cc1[N+]([O-])=O)[N+]([O-])=O |
| WGK Germany | 3 | | HS Code | 2933.99.7500 | | Storage Class | 11 - Combustible Solids |
| | 5-Aziridino-2,4-dinitrobenzamide Usage And Synthesis |
| Description | CB-1954 is a prodrug that is enzymatically activated to generate an antitumor agent that forms DNA-DNA interstrand crosslinks. In rat Walker 256 carcinoma cells, CB-1954 is reduced by NAD(P)H:quinone oxidoreductase (NQO1) to the cytotoxic derivative 5-(aziridin-1-yl)-4-hydroxylamineo 2 nitrobenzamide, a bifunctional alkylating agent. | | Uses | 5-Aziridino-2,4-dinitrobenzamide is an anticancer prodrug used in gene therapy research and is known to be activated by NAD(P)H Quinone Oxidoreductase 2. | | Uses | Tretazicar is an anticancer prodrug used in gene therapy research and is known to be activated by NAD(P)H Quinone Oxidoreductase 2. | | Biochem/physiol Actions | CB 1954 is an anticancer prodrug used in gene therapy research; activated by NAD(P)H quinone oxidoreductase2. | | in vivo | Tretazicar (CB 1954) (80 mg/kg; i.p. on days 2 and 9) results in a significant increase in survival[3]. | Animal Model: | Female BALB/c mice (AB22-nr, SKOV3 human ovarian tumour xenograft)[3] | | Dosage: | 80 mg/kg | | Administration: | i.p. on days 2 and 9 | | Result: | The median survival of the AB22-nr was 49 days. Resulted in a significant increase in survival. |
| | References | [1] R J KNOX. Bioactivation of 5-(aziridin-1-yl)-2,4-dinitrobenzamide (CB 1954) by human NAD(P)H quinone oxidoreductase 2: a novel co-substrate-mediated antitumor prodrug therapy.[J]. Cancer research, 2000, 60 15: 4179-4186.
|
| | 5-Aziridino-2,4-dinitrobenzamide Preparation Products And Raw materials |
|