|
|
| | 3,5-Diiodo-4'-(4-hydroxyphenoxy)benzoic acid Basic information |
| Product Name: | 3,5-Diiodo-4'-(4-hydroxyphenoxy)benzoic acid | | Synonyms: | Tetraiodothyroformic Acid;Levothyroxine EP IMpurity H;3,3',5,5'-Tetraiodo ThyroforMic Acid;THYROFORMIC ACID;3,3',5,5'-Tetraiodo Thyroformic Acid, >90%;Benzoic acid, 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-;3,5-DIIODOTHYROFORMIC ACID;Levothyroxine T4 benzoic acid | | CAS: | 2055-97-2 | | MF: | C13H6I4O4 | | MW: | 733.8 | | EINECS: | | | Product Categories: | Aromatics;Drug Analogues;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts | | Mol File: | 2055-97-2.mol |  |
| | 3,5-Diiodo-4'-(4-hydroxyphenoxy)benzoic acid Chemical Properties |
| Melting point | 236-239°C (dec.) | | Boiling point | 525.4±50.0 °C(Predicted) | | density | 2.830±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.48±0.10(Predicted) | | color | White to Light Brown | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C13H6I4O4/c14-7-3-6(4-8(15)11(7)18)21-12-9(16)1-5(13(19)20)2-10(12)17/h1-4,18H,(H,19,20) | | InChIKey | HKJUOMPYMPXLFS-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1 |
| | 3,5-Diiodo-4'-(4-hydroxyphenoxy)benzoic acid Usage And Synthesis |
| Chemical Properties | Salmon Pink Solid | | Uses | 3,3'',5,5''-Tetraiodo Thyroformic Acid (Levothyroxine EP Impurity H; T4-Benzoic Acid (USP)) is a thyroid hormone analogue and a potent Thyroxine impurity. |
| | 3,5-Diiodo-4'-(4-hydroxyphenoxy)benzoic acid Preparation Products And Raw materials |
|