|
|
| | 3,5-Diiodo-L-thyronine Basic information |
| Product Name: | 3,5-Diiodo-L-thyronine | | Synonyms: | 3,5-Diiodi-L-thyronine;3,5-DIIODO-L -THYRONINE 98%;3,5-Diiodo-4-(4-hydroxyphenoxy)-L-phenylalanine, O-(4-Hydroxyphenyl)-3,5-diiodo-L-tyrosine;3,5-Diiodo-O-(4-hydroxyphenyl)-L-tyrosine;L-Diiodothyronine;Alanine, 3-[4-(p-hydroxyphenoxy)-3,5-diiodophenyl]-, L-;Diiodo-L-thyronine;L-3,5-Diiodothyronine | | CAS: | 1041-01-6 | | MF: | C15H13I2NO4 | | MW: | 525.08 | | EINECS: | 213-867-7 | | Product Categories: | Amino Acids 13C, 2H, 15N;Amino Acids & Derivatives;Intermediates;Labeling and Diagnostics Reagents;Medicine intermediate | | Mol File: | 1041-01-6.mol |  |
| | 3,5-Diiodo-L-thyronine Chemical Properties |
| Melting point | 255-260 °C (dec.) | | Boiling point | 559.4±50.0 °C(Predicted) | | density | 2.095±0.06 g/cm3(Predicted) | | vapor pressure | 0.011Pa at 45℃ | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | solubility | Acidic Alcohol (Slightly), Aqueous Base (Slightly) | | form | Solid | | pka | 2.15±0.30(Predicted) | | color | White to Light Brown | | Water Solubility | 20.147mg/L at 20℃ | | BRN | 2707891 | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChI | 1S/C15H13I2NO4/c16-11-5-8(7-13(18)15(20)21)6-12(17)14(11)22-10-3-1-9(19)2-4-10/h1-6,13,19H,7,18H2,(H,20,21)/t13-/m0/s1 | | InChIKey | ZHSOTLOTTDYIIK-ZDUSSCGKSA-N | | SMILES | Ic1c(c(cc(c1)C[C@H](N)C(=O)O)I)Oc2ccc(cc2)O | | LogP | 1.1 at 25℃ | | CAS DataBase Reference | 1041-01-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | 3 | | F | 8 | | HS Code | 29225090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 |
| | 3,5-Diiodo-L-thyronine Usage And Synthesis |
| Chemical Properties | [α] 25 D +25.2° [5 % solution in 1 M HCl:95 % ethanol (1:2)], off-White Solid. | | Uses | 3,5-Diiodo-L-thyronine is an iodinated thyronine hormone that regulates gene activity affecting processes such as homeostasis, lipid metabolism and insulin resistance. | | Uses | Of interest for the early detection and treatment of congenital or drug-induced hypothyroidism. | | Definition | ChEBI: (2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid is a phenylalanine derivative. | | Flammability and Explosibility | Not classified | | Pharmacology | 3,5-Diiodo-L-thyronine is a thyroid hormone with a l-thyroxine-like activity. | | Purification Methods | Recrystallise it from EtOH. [Chambers et al. J Chem Soc 3424 1949, Beilstein 14 II 226, 14 III 1565, 14 IV 2372.] |
| | 3,5-Diiodo-L-thyronine Preparation Products And Raw materials |
|