| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Acetylphenylboronic acid, pinacol ester manufacturers
|
| | 4-Acetylphenylboronic acid, pinacol ester Basic information |
| Product Name: | 4-Acetylphenylboronic acid, pinacol ester | | Synonyms: | 1-[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]ETHANONE;1-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone ,97%;1-[4-(tetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethan-1-one;Ethanone,1-[4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl]-;2-(4-Acetylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4-Acetylbenzeneboronic acid pinacol ester;4-ethylacylbenzeneboronic acidolester;4-Acetylphenylboronic acid, pinacol ester | | CAS: | 171364-81-1 | | MF: | C14H19BO3 | | MW: | 246.11 | | EINECS: | | | Product Categories: | | | Mol File: | 171364-81-1.mol |  |
| | 4-Acetylphenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 63-65°C | | Boiling point | 356.6±25.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Crystalline Powder | | color | White | | InChI | 1S/C14H19BO3/c1-10(16)11-6-8-12(9-7-11)15-17-13(2,3)14(4,5)18-15/h6-9H,1-5H3 | | InChIKey | BATKIZWNRQGSKE-UHFFFAOYSA-N | | SMILES | CC(=O)c1ccc(cc1)B2OC(C)(C)C(C)(C)O2 |
| WGK Germany | WGK 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 4-Acetylphenylboronic acid, pinacol ester Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | 4-Acetylphenylboronic acid, pinacol ester |
| | 4-Acetylphenylboronic acid, pinacol ester Preparation Products And Raw materials |
|