- PYRONINE B
-
- $2.20
-
2026-08-25
- CAS:2150-48-3
- Min. Order: 1KG
- Purity: 99%
- PYRONINE B
-
- $1.00
-
2019-07-06
- CAS:2150-48-3
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 1000kg
|
| | CI 45010 Basic information |
| | CI 45010 Chemical Properties |
| Melting point | 174-176 °C | | storage temp. | Store at RT. | | solubility | Soluble in water, ethyl acetate, methyl acetate, ethylene glycol; slightly soluble in ethanol, methanol, methyl cellosolve | | form | crystals | | Colour Index | 45010 | | color | Green needles or | | Water Solubility | water: 1mg/mL | | Merck | 13,8096 | | BRN | 3846969 | | Major Application | diagnostic assay manufacturing hematology histology | | Biological Applications | Detecting apoptosis in live cells; determination of DNA,hydrogen peroxide,glucose; diagnosis of diseases related to amyloid accumulation; urinary tract infection; treating protozoan infections in fish | | InChI | InChI=1S/C21H27N2O.ClH/c1-5-22(6-2)18-11-9-16-13-17-10-12-19(23(7-3)8-4)15-21(17)24-20(16)14-18;/h9-15H,5-8H2,1-4H3;1H/q+1;/p-1 | | InChIKey | SUVPQRYDMCNTPV-UHFFFAOYSA-J | | SMILES | N(C1C=CC2=CC3=CC=C(N(CC)CC)C=C3[O+]=C2C=1)(CC)CC.[Cl-] | | EPA Substance Registry System | Pyronine B (2150-48-3) |
| Hazard Codes | Xn | | Risk Statements | 68-40-20/21/22 | | Safety Statements | 45-36/37-24/25-22-36 | | WGK Germany | 3 | | RTECS | BP6832000 | | TSCA | TSCA listed | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,intraperitoneal,15100ug/kg (15.1mg/kg),National Cancer Institute Screening Program Data Summary, Developmental Therapeutics Program. Vol. JAN1986, |
| Provider | Language |
|
ACROS
| English |
| | CI 45010 Usage And Synthesis |
| Chemical Properties | dark green crystalline powder or crystals | | Uses | Pyronin B is used in the methyl green-pyronin method for coloration of nucleic acids. Pyronin B Ferric Chloride Complex is used in the methyl green-pyronin method for differential coloration of nucleic acids. Dyes and metabolites. | | Definition | ChEBI: Pyronin B is an organic chloride salt having 6-(diethylamino)-N,N-diethyl-3H-xanthen-3-iminium as the cation. Depending on the mode of manufacture, pyronin B also exists in the form of an FeCl3 complex. It has a role as a histological dye. It is an organic chloride salt and an iminium salt. It contains a pyronin B(1+). | | Purification Methods | Recrystallise it from EtOH. It forms an Fe stain. [Beilstein 18/10 V 182.] |
| | CI 45010 Preparation Products And Raw materials |
|