| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 5-Fluoroindoline
-
- $9.85
-
2026-03-20
- CAS:2343-22-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 m
|
| | 5-Fluoroindoline Basic information |
| Product Name: | 5-Fluoroindoline | | Synonyms: | 2,3-DIHYDRO-5-FLUORO(1H)-INDOLE;5-FLUOROINDOLINE;5-FLUORO-2,3-DIHYDRO-(1H)-INDOLE;1H-Indole, 5-fluoro-2,3-dihydro-;5-Fluoroindoline 97%;5-Fluoroindoline 5-Fluoro-2,3-dihydro-(1H)-indole in stock Factory;Chiglitazar Impurity 24 | | CAS: | 2343-22-8 | | MF: | C8H8FN | | MW: | 137.15 | | EINECS: | 607-884-2 | | Product Categories: | | | Mol File: | 2343-22-8.mol |  |
| | 5-Fluoroindoline Chemical Properties |
| Melting point | 116-118 °C | | Boiling point | 102-104°C 7mm | | density | 1.171 g/mL at 25 °C | | refractive index | n/D1.556 | | Fp | 107℃ | | storage temp. | 2-8°C | | pka | 5.19±0.20(Predicted) | | form | oil | | color | Colourless to light green or yellow | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C8H8FN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,5,10H,3-4H2 | | InChIKey | NXQRMQIYCWFDGP-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(F)C=C2)CC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-37 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2933998090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Fluoroindoline Usage And Synthesis |
| Uses | 5-Fluoroindoline is used as pharmaceutical intermediate. |
| | 5-Fluoroindoline Preparation Products And Raw materials |
|