- Oroxin A
-
- $36.00
-
2026-07-27
- CAS:57396-78-8
- Purity: 99.74%
- Supply Ability: 10g
- Oroxin A
-
-
2023-02-24
- CAS:57396-78-8
- Min. Order: 20mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Oroxin A
-
- $9.80
-
2020-01-10
- CAS:57396-78-8
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | Baicalein 7-O-β-D-glucopyranoside (baicalin) Basic information |
| Product Name: | Baicalein 7-O-β-D-glucopyranoside (baicalin) | | Synonyms: | Biacalein 7-O-glucoside;Baicalein 7-glucoside;5,6-Dihydroxy-7-(β-D-glucopyranosyloxy)-2-phenyl-4H-1-benzopyran-4-one;5,6-Dihydroxy-7-(β-D-glucopyranosyloxy)flavone;5,6-Dihydroxyflavone-7-yl β-D-glucopyranoside;7-(β-D-Glucopyranosyloxy)-5,6-dihydroxy-2-phenyl-4H-1-benzopyran-4-one;7-(β-D-Glucopyranosyloxy)-5,6-dihydroxyflavone;Baicaleine-7-glucoside | | CAS: | 57396-78-8 | | MF: | C21H20O10 | | MW: | 432.38 | | EINECS: | | | Product Categories: | | | Mol File: | 57396-78-8.mol |  |
| | Baicalein 7-O-β-D-glucopyranoside (baicalin) Chemical Properties |
| Boiling point | 784.0±60.0 °C(Predicted) | | density | 1.642±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C(protect from light) | | solubility | Soluble in methanol and water | | form | powder | | pka | 5.92±0.40(Predicted) | | color | Yellow | | Major Application | food and beverages | | InChIKey | IPQKDIRUZHOIOM-IAAKTDFRSA-N | | SMILES | OC1C(=C(C=C2OC(C3C=CC=CC=3)=CC(C2=1)=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Baicalein 7-O-β-D-glucopyranoside (baicalin) Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Scutellaria baicalensis and Oroxylum indicum. | | Uses | food and beverages | | IC 50 | PPARγ |
| | Baicalein 7-O-β-D-glucopyranoside (baicalin) Preparation Products And Raw materials |
|