| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1R,2S)-(-)-trans-2-Phenyl-1-cyclohexanol Basic information |
| Product Name: | (1R,2S)-(-)-trans-2-Phenyl-1-cyclohexanol | | Synonyms: | (1R,2S)-TRANS-2-PHENYL-1-CYCLOHEXANOL;(1R,2S)-(-)-TRANS-2-PHENYL-1-CYCLOHEXANO L, 99% (99% EE/GLC);(1R,2S)-2-PHENYL-CYCLOHEXANOL;(1R,2S)-2-Phenyl-1-cyclohexanol,99%e.e.;(1R-trans)-2-Phenylcyclohexanol;(1R,2S)-trans-2-phenylcyclohexanol;N-(4-chlorophenyl)-2-oxo-1,3,2$l^{5}-diazaphosphorinan-2-amine;(1R,2S)-2-Phenyl-1-cyclohexanol, 98%, (99% ee) | | CAS: | 98919-68-7 | | MF: | C12H16O | | MW: | 176.25 | | EINECS: | | | Product Categories: | chiral;Asymmetric Synthesis;Synthetic Organic Chemistry;Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 98919-68-7.mol |  |
| | (1R,2S)-(-)-trans-2-Phenyl-1-cyclohexanol Chemical Properties |
| Melting point | 63-66 °C(lit.) | | Boiling point | 276-281 °C(lit.) | | density | 0.9452 (rough estimate) | | refractive index | -58 ° (C=1, MeOH) | | storage temp. | 2-8°C | | solubility | almost transparency in Methanol | | form | powder to crystal | | pka | 15.05±0.40(Predicted) | | color | White to Almost white | | Optical Rotation | [α]20/D 58°, c = 10 in methanol | | BRN | 2047602 | | CAS DataBase Reference | 98919-68-7(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29062990 |
| | (1R,2S)-(-)-trans-2-Phenyl-1-cyclohexanol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde |
| | (1R,2S)-(-)-trans-2-Phenyl-1-cyclohexanol Preparation Products And Raw materials |
|