| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
4,4'-Difluorodiphenylmethane manufacturers
|
| | 4,4'-Difluorodiphenylmethane Basic information |
| | 4,4'-Difluorodiphenylmethane Chemical Properties |
| Melting point | 29-30 °C(lit.) | | Boiling point | 258-260 °C742 mm Hg(lit.) | | density | 1.145 g/mL at 25 °C(lit.) | | vapor pressure | 0.933Pa at 50℃ | | refractive index | n20/D 1.536(lit.) | | Fp | >230 °F | | storage temp. | 2-30°C | | form | Crystalline | | color | White or Colorless to Light yellow | | Specific Gravity | 1.145 | | Water Solubility | Insoluble in water. | | BRN | 1956387 | | InChI | InChI=1S/C13H10F2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8H,9H2 | | InChIKey | DXQVFHQUHOFROC-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(F)C=C1)C1=CC=C(F)C=C1 | | CAS DataBase Reference | 457-68-1(CAS DataBase Reference) | | NIST Chemistry Reference | Bis(4-fluorophenyl)methane(457-68-1) |
| Hazard Codes | Xn,Xi | | Risk Statements | 21/22 | | Safety Statements | 28A-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29036990 | | Storage Class | 11 - Combustible Solids |
| | 4,4'-Difluorodiphenylmethane Usage And Synthesis |
| Chemical Properties | CLEAR COLORLESS TO YELLOWISH LIQUID AFTER MELTING | | Uses | It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | 4,4'-Difluorodiphenylmethane Preparation Products And Raw materials |
|