| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5'-Chloro-2'-hydroxy-3'-nitroacetophenone Basic information |
| | 5'-Chloro-2'-hydroxy-3'-nitroacetophenone Chemical Properties |
| Melting point | 132-135 °C(lit.) | | storage temp. | RT, stored under nitrogen | | form | powder to crystal | | color | White to Yellow to Orange | | InChI | 1S/C8H6ClNO4/c1-4(11)6-2-5(9)3-7(8(6)12)10(13)14/h2-3,12H,1H3 | | InChIKey | IUNBIQBAYUBIFD-UHFFFAOYSA-N | | SMILES | CC(=O)c1cc(Cl)cc(c1O)[N+]([O-])=O | | CAS DataBase Reference | 84942-40-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2914390090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5'-Chloro-2'-hydroxy-3'-nitroacetophenone Usage And Synthesis |
| Uses | 5′-Chloro-2′-hydroxy-3′-nitroacetophenone may be used for the synthesis of 6-chloro-8-nitro-4-oxo-4H-chromene-3-carbaldehyde. | | Preparation | Preparation by reaction of nitric acid on 5-chloro-2- hydroxyacetophenone in acetic acid at r.t. | | General Description | 5′-Chloro-2′-hydroxy-3′-nitroacetophenone (5-chloro-3-nitro-2-hydroxyacetophenone) is a nitro derivative of ortho-hydroxy aryl ketone. Its crystal structure has been studied by X-ray diffraction. It forms complex with 2-aminobenzoic acid (anthranilic acid), in which the nitro group is turned by approximately 40°C. |
| | 5'-Chloro-2'-hydroxy-3'-nitroacetophenone Preparation Products And Raw materials |
|