- L-Glu-Obzl
-
- $0.00 / 1kg
-
2025-09-30
- CAS:13030-09-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-Glutamic acid alpha-benzyl ester Basic information |
| | L-Glutamic acid alpha-benzyl ester Chemical Properties |
| Melting point | 157 °C | | Boiling point | 416.0±40.0 °C(Predicted) | | density | 1.245±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | 4.21±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C12H15NO4/c13-10(6-7-11(14)15)12(16)17-8-9-4-2-1-3-5-9/h1-5,10H,6-8,13H2,(H,14,15)/t10-/m0/s1 | | InChIKey | HFZKKJHBHCZXTQ-JTQLQIEISA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)[C@H](CCC(O)=O)N | | CAS DataBase Reference | 13030-09-6(CAS DataBase Reference) |
| | L-Glutamic acid alpha-benzyl ester Usage And Synthesis |
| Chemical Properties | White solid | | Uses | H-Glu-Obzl is a glutamic acid derivative[1]. | | Synthesis | The general procedure for the synthesis of L-glutamic acid-5-benzyl ester and (S)-4-amino-5-(benzyloxy)-5-oxopentanoic acid from L-glutamic acid and benzyl alcohol was as follows: under typical reaction conditions, 6.8 mmol L-glutamic acid, 10.2 mmol benzyl alcohol (the molar ratio of L-glutamic acid to benzyl alcohol was 1:1.5), and 0.68 mmol CuCl2 were added to a 50 mL single-necked reaction flask. The reaction mixture was stirred at 60 °C for 2 hours. Upon completion of the reaction, the reaction mixture was cooled to room temperature, followed by subsequent analysis. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | L-Glutamic acid alpha-benzyl ester Preparation Products And Raw materials |
|