| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Fluoro-4-(methoxycarbonyl)phenylboronic acid,pinacol ester manufacturers
|
| | 2-Fluoro-4-(methoxycarbonyl)phenylboronic acid,pinacol ester Basic information |
| Product Name: | 2-Fluoro-4-(methoxycarbonyl)phenylboronic acid,pinacol ester | | Synonyms: | 2-Fluoro-4-(methoxycarbonyl)phenylboronic acid,pinacol ester;Methyl 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;Fluoro-4-(Methoxycarbonyl)phenylboronic acid,pinacol ester;2-Fluoro-4-(Methoxycarbonyl)benzeneboronic acid pinacol ester, 96%;Methyl 3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan;Benzoic acid, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester;methyl 3-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;2-Fluoro-4-(methoxycarbonyl)phenylboronic acid pinacol ester | | CAS: | 603122-79-8 | | MF: | C14H18BFO4 | | MW: | 280.1 | | EINECS: | | | Product Categories: | | | Mol File: | 603122-79-8.mol |  |
| | 2-Fluoro-4-(methoxycarbonyl)phenylboronic acid,pinacol ester Chemical Properties |
| Melting point | 56-58℃ | | Boiling point | 362.5±37.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C14H18BFO4/c1-13(2)14(3,4)20-15(19-13)10-7-6-9(8-11(10)16)12(17)18-5/h6-8H,1-5H3 | | InChIKey | HPLWCULFGNLCFB-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Fluoro-4-(methoxycarbonyl)phenylboronic acid,pinacol ester Usage And Synthesis |
| Uses | 2-Fluoro-4-(methoxycarbonyl)phenylboronic acid, pinacol ester |
| | 2-Fluoro-4-(methoxycarbonyl)phenylboronic acid,pinacol ester Preparation Products And Raw materials |
|