| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Fluoro-2-methylphenylboronic acid, pinacol ester manufacturers
|
| | 4-Fluoro-2-methylphenylboronic acid, pinacol ester Basic information |
| Product Name: | 4-Fluoro-2-methylphenylboronic acid, pinacol ester | | Synonyms: | 2-(4-FLUORO-2-METHYLPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;4-Fluoro-2-Methylbenzeneboronic acid pinacol ester, 96%;1,3,2-Dioxaborolane, 2-(4-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-;4-Fluoro-2-Methylphenyl)-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane;4-Fluoro-2-methylbenzeneboronic acid pinacol ester;4-fluoro-2-methylbenzeneboronic acidolester;4-Fluoro-2-methylphenylboronic acid, pinacol ester | | CAS: | 815631-56-2 | | MF: | C13H18BFO2 | | MW: | 236.09 | | EINECS: | | | Product Categories: | blocks;BoronicAcids | | Mol File: | 815631-56-2.mol |  |
| | 4-Fluoro-2-methylphenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 61-64°C | | Boiling point | 300.7±35.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | Appearance | White to off-white Solid | | InChI | 1S/C13H18BFO2/c1-9-8-10(15)6-7-11(9)14-16-12(2,3)13(4,5)17-14/h6-8H,1-5H3 | | InChIKey | HHWOQSZBVGPYMH-UHFFFAOYSA-N | | SMILES | B2(OC(C(O2)(C)C)(C)C)c1c(cc(cc1)F)C | | CAS DataBase Reference | 815631-56-2 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 4-Fluoro-2-methylphenylboronic acid, pinacol ester Usage And Synthesis |
| | 4-Fluoro-2-methylphenylboronic acid, pinacol ester Preparation Products And Raw materials |
|