|
|
| | 3-benzyl-6-bromo-2-chloroquinoline Basic information |
| Product Name: | 3-benzyl-6-bromo-2-chloroquinoline | | Synonyms: | 3-benzyl-6-bromo-2-chloroquinoline;6-Bromo-2-chloro-3-(phenylmethyl)quinoline;Quinoline, 6-bromo-2-chloro-3-(phenylmethyl)-;Bedaquiline Fumarate Impurity 5;3-benzyl-6-bromo-2-chloroquinoline(Beida quinoline intermediate );6-Bromo-3-benzyl-2-chloroquinolone;Brilanestrant Impurity 11;Bedaquiline Impurity B | | CAS: | 654655-68-2 | | MF: | C16H11BrClN | | MW: | 332.62 | | EINECS: | | | Product Categories: | bedaquiline intermediates | | Mol File: | 654655-68-2.mol |  |
| | 3-benzyl-6-bromo-2-chloroquinoline Chemical Properties |
| Melting point | 111-112℃ | | Boiling point | 435.9±40.0 °C(Predicted) | | density | 1.482±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -0.42±0.50(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C16H11BrClN/c17-14-6-7-15-12(10-14)9-13(16(18)19-15)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2 | | InChIKey | UGXUDVNBDYIJHJ-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(Br)=CC=2)C=C(CC2=CC=CC=C2)C=1Cl |
| | 3-benzyl-6-bromo-2-chloroquinoline Usage And Synthesis |
| Uses | 3-Benzyl-6-bromo-2-chloroquinoline is an intermediate in the synthesis of (αS,βR)-Bedaquiline (B119540), which is a diarylquinoline derivative that acts as a mycobacterial inhibitor. Bedaquiline shows promise as potential drug in the treatment of tuberculosis. | | References | [1] Tetrahedron, 2007, vol. 63, # 2, p. 451 - 460 [2] Patent: WO2009/91324, 2009, A1. Location in patent: Page/Page column 20-21 |
| | 3-benzyl-6-bromo-2-chloroquinoline Preparation Products And Raw materials |
|