|
|
| | 5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)-pyridine Basic information |
| | 5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)-pyridine Chemical Properties |
| Boiling point | 375.2±52.0 °C(Predicted) | | density | 1.85±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Dichloromethane | | pka | 0.94±0.10(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C7H6BrN5/c1-13-11-7(10-12-13)6-3-2-5(8)4-9-6/h2-4H,1H3 | | InChIKey | JANKGNBDRWYWSN-UHFFFAOYSA-N | | SMILES | C1(C2=NN(C)N=N2)=NC=C(Br)C=C1 |
| | 5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)-pyridine Usage And Synthesis |
| Uses | 5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)pyridine-d3 is an intermediate in synthesizing Tedizolid-d3 (T013752), a labelled form of Tedizolid, known as TR-700, which is an oral and i.v administered intracellular antibacterial drug. | | Synthesis | 1. 5-Bromo-2-(2H-tetrazol-5-yl)pyridine (226 g), formaldehyde (90 g) and 10% palladium-carbon catalyst (20 g) were added to a reactor in 1.5 L of methanol. 2. The reaction was stirred at room temperature under hydrogen atmosphere (0.2 MPa) for 3 h. 3. Upon completion of the reaction, the organic phase was removed by evaporation. 4. The residue was recrystallized using acetonitrile to afford the target product 2-methyl-5-(5-bromo-2-pyridinyl)tetrazole (217 g) in 90.4% yield. | | References | [1] Patent: CN106632240, 2017, A. Location in patent: Paragraph 0018-0019 |
| | 5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)-pyridine Preparation Products And Raw materials |
|