| Company Name: |
NCE Biomedical Co.,Ltd. |
| Tel: |
4000-027-021 |24 +86-13986109188 | +86-15623472865 | +81-08033611988 |
| Email: |
|
LCI699 manufacturers
- LCI699
-
- $1.00
-
2019-12-27
- CAS:928134-65-0
- Min. Order: 1KG
- Purity: 97%-99.9%
- Supply Ability: 100kg
|
| Product Name: | LCI699 | | Synonyms: | LCI699;4-(R)-(6,7-Dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl)-3-fluorobenzonitrile;LCI 699NX;Osilodrostat (LCI699);CS-2488;Osilodrostat(LCI699) free base;Benzonitrile, 4-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-3-fluoro-;Isturisa (Osilodrostat) | | CAS: | 928134-65-0 | | MF: | C13H10FN3 | | MW: | 227.24 | | EINECS: | | | Product Categories: | | | Mol File: | 928134-65-0.mol |  |
| | LCI699 Chemical Properties |
| Boiling point | 433.8±45.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | solubility | DMSO:147.5(Max Conc. mg/mL);649.1(Max Conc. mM)
Ethanol:72.5(Max Conc. mg/mL);319.05(Max Conc. mM) | | form | A solid | | pka | 6.97±0.40(Predicted) | | color | White to yellow | | InChI | InChI=1S/C13H10FN3/c14-12-5-9(6-15)1-3-11(12)13-4-2-10-7-16-8-17(10)13/h1,3,5,7-8,13H,2,4H2/t13-/m1/s1 | | InChIKey | USUZGMWDZDXMDG-CYBMUJFWSA-N | | SMILES | C(#N)C1=CC=C([C@@H]2N3C(CC2)=CN=C3)C(F)=C1 |
| | LCI699 Usage And Synthesis |
| Uses | Osilodrostat is a novel 11-β-hydroxylase inhibitor which may be used in the treatment of Cushing’s syndrome, | | in vivo | Osilodrostat (LCI699; 0.1-100 mg/kg; p.o.; once) inhibits aldosterone and corticosterone synthesis in Ang-II- and ACTH-stimulated Sprague Dawley rats[1].
Osilodrostat (LCI699; 3-100 mg/kg; p.o.; daily, for 52 weeks) reduces mean arterial pressure and prolongs survival in dTG rats[1]. | Animal Model: | Male Ang-II- and ACTH-stimulated Sprague Dawley rats[1] | | Dosage: | 0.1, 0.3, 1 and 3 mg/kg (Ang-II-stimulated rats) and 1, 3, 10, 30 and 100 mg/kg (ACTH-stimulated rats) | | Administration: | Oral administration; once | | Result: | Inhibited the increase in plasma aldosterone concentrations stimulated by Ang II or ACTH in a dose-dependent manner. |
| Animal Model: | dTG rats[1] | | Dosage: | 3, 10, 30 and 100 mg/kg | | Administration: | Oral administration; daily, for 52 weeks | | Result: | Increased fractional LV (systolic and diastolic) shortening, normalized LV isovolumic relaxation time to RR (IVRT/RR) ratio and myocardial cell size and reduced LV weight in a dose-dependent manner. |
|
| | LCI699 Preparation Products And Raw materials |
|