|
|
| | (-)-MENTHOXYACETYL CHLORIDE Basic information |
| | (-)-MENTHOXYACETYL CHLORIDE Chemical Properties |
| Boiling point | 136 °C / 12mmHg | | density | 1.033 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.469(lit.) | | Fp | >230 °F | | Optical Rotation | [α]25/D 10°, neat | | InChI | 1S/C12H21ClO2/c1-8(2)10-5-4-9(3)6-11(10)15-7-12(13)14/h8-11H,4-7H2,1-3H3/t9-,10+,11-/m1/s1 | | InChIKey | VNMCKLVHDJADEB-OUAUKWLOSA-N | | SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCC(Cl)=O | | CAS DataBase Reference | 15356-62-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 3 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29181990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | (-)-MENTHOXYACETYL CHLORIDE Usage And Synthesis |
| Uses | (-)-Menthoxyacetyl chloride is used as a resolving agent for a variety of racemic mixtures (such as amino acids). |
| | (-)-MENTHOXYACETYL CHLORIDE Preparation Products And Raw materials |
|