| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
N-Boc-5-Methoxy-7-Methylindole, 97% manufacturers
|
| | N-Boc-5-Methoxy-7-Methylindole, 97% Basic information |
| Product Name: | N-Boc-5-Methoxy-7-Methylindole, 97% | | Synonyms: | N-Boc-5-Methoxy-7-Methylindole, 97%;EOS-60928;N-Boc-5-methoxy-7-methylindole,97%;5-Methoxy-7-methylindole-1-carboxylic acid tert-butyl ester;1H-Indole-1-carboxylic acid, 5-methoxy-7-methyl-, 1,1-dimethylethyl ester;1-Boc-5-methoxy-7-methylindole;tert-butyl 5-methoxy-7-methyl-indole-1-carboxylate;1,1-Dimethylethyl 5-methoxy-7-methyl-1H-indole-1-carboxylate - [AC77794] | | CAS: | 1387445-50-2 | | MF: | C15H19NO3 | | MW: | 261.32 | | EINECS: | | | Product Categories: | | | Mol File: | 1387445-50-2.mol |  |
| | N-Boc-5-Methoxy-7-Methylindole, 97% Chemical Properties |
| Boiling point | 377.5±34.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H19NO3/c1-10-8-12(18-5)9-11-6-7-16(13(10)11)14(17)19-15(2,3)4/h6-9H,1-5H3 | | InChIKey | OMZYGXJHKONVSJ-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C2=C(C=C(OC)C=C2C)C=C1 |
| | N-Boc-5-Methoxy-7-Methylindole, 97% Usage And Synthesis |
| | N-Boc-5-Methoxy-7-Methylindole, 97% Preparation Products And Raw materials |
|