| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 5-Methoxy-7-methyl-1H-indole Basic information |
| Product Name: | 5-Methoxy-7-methyl-1H-indole | | Synonyms: | 5-METHOXY-7-METHYLINDOLE;EOS-60929;5-METHOXY-7-METHYLINDOLE (Related Reference);1H-Indole, 5-methoxy-7-methyl-;5-Methoxy-7-methylindole,97%;1,3,5-Triazine,2,4-dichloro-6-(4-pyrenyl)-;Methylindole impurities1;5-methoxy-7-methyl-1H-indole | | CAS: | 61019-05-4 | | MF: | C10H11NO | | MW: | 161.2 | | EINECS: | | | Product Categories: | | | Mol File: | 61019-05-4.mol |  |
| | 5-Methoxy-7-methyl-1H-indole Chemical Properties |
| Melting point | 65-66 °C | | Boiling point | 100-110 °C(Press: 0.15 Torr) | | density | 1.134±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | pka | 17.00±0.30(Predicted) | | Appearance | Light brown to brown Solid | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C10H11NO/c1-7-5-9(12-2)6-8-3-4-11-10(7)8/h3-6,11H,1-2H3 | | InChIKey | YGPVRHHGKCQSIL-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC)C=C2C)C=C1 | | CAS DataBase Reference | 61019-05-4 |
| | 5-Methoxy-7-methyl-1H-indole Usage And Synthesis |
| Uses | 5-Methoxy-7-methylindole is employed as a intermediate for chemical research and pharmaceutical. |
| | 5-Methoxy-7-methyl-1H-indole Preparation Products And Raw materials |
|