| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 6-Bromo-4-hydroxyquinoline-3-carboxylic acid Basic information |
| Product Name: | 6-Bromo-4-hydroxyquinoline-3-carboxylic acid | | Synonyms: | OTAVA-BB BB7110950773;AURORA 19699;BUTTPARK 21\09-50;4-Hydroxy-6-broMoquinoline-3-carboxylic acid;6-BROMO-4-HYDROXYQUINOLINE-3-CARBOXYLIC ACID CAS:98948-95-9;6-bromo-4-hydroxy-3-quinolinecarboxylic acid;3-Quinolinecarboxylic acid, 6-bromo-4-hydroxy-;6-Bromo-4-hydroxyquinoline-3-carboxylic acid | | CAS: | 98948-95-9 | | MF: | C10H6BrNO3 | | MW: | 268.06 | | EINECS: | 804-515-9 | | Product Categories: | CHIRAL CHEMICALS | | Mol File: | 98948-95-9.mol |  |
| | 6-Bromo-4-hydroxyquinoline-3-carboxylic acid Chemical Properties |
| Melting point | 271 °C (decomp) | | Boiling point | 436.9±45.0 °C(Predicted) | | density | 1.862±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 0.59±0.30(Predicted) | | form | solid | | Appearance | Off-white to gray Solid | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C10H6BrNO3/c11-5-1-2-8-6(3-5)9(13)7(4-12-8)10(14)15/h1-4H,(H,12,13)(H,14,15) | | InChIKey | GIUZUAUCCUFVKW-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(Br)=CC=2)C(O)=C(C(O)=O)C=1 | | CAS DataBase Reference | 98948-95-9 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 6-Bromo-4-hydroxyquinoline-3-carboxylic acid Usage And Synthesis |
| Uses | It is used as a pharmaceutical intermediate. | | Synthesis | The general procedure for the synthesis of 4-hydroxy-6-bromoquinoline-3-carboxylic acid from ethyl 6-bromo-4-hydroxy-3-quinolinecarboxylate was as follows: ethyl 6-bromo-4-hydroxy-3-quinolinecarboxylate (102.59 g, 337.7 mmol) was suspended in a 10% aqueous potassium hydroxide solution (689 mL) and heated and refluxed for 5 hours, and the reaction solution changed to light brown. After completion of the reaction, it was cooled to room temperature and filtered to remove undissolved solid particles. The filtrate was extracted with dichloromethane to remove neutral impurities. The aqueous layer was neutralized with 3.0 N hydrochloric acid to precipitate a white precipitate. The solid was collected by filtration and washed with water. After drying in air, 4-hydroxy-6-bromoquinoline-3-carboxylic acid was obtained as 91 g (98% yield) as a white solid.EI-HRMS m/e calculated value of C10H6BrNO3 (M+) 266.9531, measured value 266.9521. | | References | [1] Patent: US2006/63805, 2006, A1. Location in patent: Page/Page column 9 [2] ChemMedChem, 2015, vol. 10, # 5, p. 836 - 849 [3] Patent: CN106432073, 2017, A. Location in patent: Paragraph 0061; 0062; 0067; 0068 [4] European Journal of Medicinal Chemistry, 2015, vol. 99, p. 36 - 50 [5] Chemistry of Heterocyclic Compounds (New York, NY, United States), 1995, vol. 31, # 2, p. 167 - 175 |
| | 6-Bromo-4-hydroxyquinoline-3-carboxylic acid Preparation Products And Raw materials |
|