|
|
| | 6-Bromoquinoline-3-carboxylic acid Basic information |
| | 6-Bromoquinoline-3-carboxylic acid Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | powder | | color | Off-white | | InChI | 1S/C10H6BrNO2/c11-8-1-2-9-6(4-8)3-7(5-12-9)10(13)14/h1-5H,(H,13,14) | | InChIKey | HVNYDSMSHWJYHG-UHFFFAOYSA-N | | SMILES | Brc1cc2c(ncc(c2)C(=O)O)cc1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 6-Bromoquinoline-3-carboxylic acid Usage And Synthesis |
| | 6-Bromoquinoline-3-carboxylic acid Preparation Products And Raw materials |
|