Phe-Lys(FMoc)-PAB manufacturers
|
| | Phe-Lys(FMoc)-PAB Basic information |
| | Phe-Lys(FMoc)-PAB Chemical Properties |
| Boiling point | 931.0±65.0 °C(Predicted) | | density | 1.260±0.06 g/cm3(Predicted) | | pka | 12.24±0.46(Predicted) | | form | Solid | | color | Off-white to light yellow | | InChIKey | RCPHMUPZDFKBDS-WPFLMDKRNA-N | | SMILES | C(C1C2=CC=CC=C2C2=CC=CC=C12)OC(=O)NCCCC[C@H](NC(=O)[C@@H](N)CC1C=CC=CC=1)C(=O)NC1C=CC(CO)=CC=1 |&1:22,26,r| |
| | Phe-Lys(FMoc)-PAB Usage And Synthesis |
| Uses | Phe-Lys(FMoc)-PAB is a protease-cleavable ADC linker for the synthesis of antibody-drug conjugates (ADCs). | | IC 50 | Cleavable Linker; Protease Cleavable Linker |
| | Phe-Lys(FMoc)-PAB Preparation Products And Raw materials |
|