| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Entacapone EP Impurity G Basic information |
| Product Name: | Entacapone EP Impurity G | | Synonyms: | Entacapone EP Impurity G;N,N-Bis-desethyl, N-Methyl Entacapone;2-Propenamide, 2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N-methyl-, (2E)-;(E)-2-Cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N-methylacrylamide (Entacapone Impurity);(E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N-methylacrylamide | | CAS: | 1364322-41-7 | | MF: | C11H9N3O5 | | MW: | 263.21 | | EINECS: | | | Product Categories: | | | Mol File: | 1364322-41-7.mol |  |
| | Entacapone EP Impurity G Chemical Properties |
| Melting point | 246-250 °C | | Boiling point | 544.6±50.0 °C(Predicted) | | density | 1.537±0.06 g/cm3(Predicted) | | pka | 4.88±0.50(Predicted) | | InChI | InChI=1S/C11H9N3O5/c1-13-11(17)7(5-12)2-6-3-8(14(18)19)10(16)9(15)4-6/h2-4,15-16H,1H3,(H,13,17)/b7-2+ | | InChIKey | PJVWDBNDLNEXCN-FARCUNLSSA-N | | SMILES | C(NC)(=O)/C(/C#N)=C/C1=CC([N+]([O-])=O)=C(O)C(O)=C1 |
| | Entacapone EP Impurity G Usage And Synthesis |
| Uses | N,N-Bis-desethyl, N-Methyl Entacapone is an impurity of Entacapone (E558500). The (E)-Isomer of Entacapone which is a polymorphic form A. Peripherally acting inhibitor of catechol-O-methyl transferase (COMT), an enzyme involved in the metabolism of catecholamine neurotransmitters and related drugs. Antiparkinsonian. |
| | Entacapone EP Impurity G Preparation Products And Raw materials |
|