| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Oleuropeinic acid manufacturers
- Oleuropeinic acid
-
- $73.00
-
2026-07-16
- CAS:96382-90-0
- Purity: 98.49%
- Supply Ability: 10g
- Oleuropeinic acid
-
- $73.00
-
2026-07-15
- CAS:96382-90-0
- Purity: 98.49%
- Supply Ability: 10g
|
| | Oleuropeinic acid Basic information |
| Product Name: | Oleuropeinic acid | | Synonyms: | Oleuropeinic acid;Oleuropeinic acid >=85% (LC/MS-ELSD);inhibit,Inhibitor,thermal,Oleuropeinic acid,Olive,fiber,oleuropein,oxidation,soluble,antioxidant;2H-Pyran-4-acetic acid, 3-(carboxymethylene)-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-, 4-[2-(3,4-dihydroxyphenyl)ethyl] ester, (2S,3E,4S)-;(E)-2-((2S,4S)-4-(2-(3,4-Dihydroxyphenethoxy)-2-oxoethyl)-5-(methoxycarbonyl)-2-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-2H-pyran-3(4H)-ylidene)acetic acid;Oleuropeinic acid, 10 mM in DMSO | | CAS: | 96382-90-0 | | MF: | C25H30O15 | | MW: | 570.5 | | EINECS: | | | Product Categories: | | | Mol File: | 96382-90-0.mol |  |
| | Oleuropeinic acid Chemical Properties |
| Boiling point | 869.0±65.0 °C(Predicted) | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO | | form | Solid | | pka | 3.77±0.41(Predicted) | | color | White to off-white | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | XJDJODWHDUVAGF-HITGIGKYSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC2OC=C(C(\C\2=C/C(=O)O)CC(=O)OCCc3cc(c(cc3)O)O)C(=O)OC |
| Risk Statements | 50 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 |
| | Oleuropeinic acid Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products | | General Description | Natural product derived from plant source. |
| | Oleuropeinic acid Preparation Products And Raw materials |
|