|
|
| | DBD-PZ Chemical Properties |
| Melting point | 121.0 to 125.0 °C | | Boiling point | 513.5±60.0 °C(Predicted) | | density | 1.373±0.06 g/cm3(Predicted) | | pka | 8.41±0.10(Predicted) | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C12H17N5O3S/c1-16(2)21(18,19)10-4-3-9(11-12(10)15-20-14-11)17-7-5-13-6-8-17/h3-4,13H,5-8H2,1-2H3 | | InChIKey | XFQLOSBBYVMBGT-UHFFFAOYSA-N | | SMILES | N1=C2C(N3CCNCC3)=CC=C(S(N(C)C)(=O)=O)C2=NO1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 9 | | HS Code | 2935.90.9500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DBD-PZ Usage And Synthesis |
| Uses | DBD-PZ is a fluorogenic tagging reagent mostly used in HPLC for carboxylic acids. |
| | DBD-PZ Preparation Products And Raw materials |
|