|
|
| | 2-METHYL-6-NITROBENZONITRILE Basic information |
| Product Name: | 2-METHYL-6-NITROBENZONITRILE | | Synonyms: | 2-METHYL-6-NITROBENZONITRILE;6-nitro-2-toluonitrile;6-NITRO-O-TOLUNITRILE;2-methyl-6-nitro-benzenecarbonitrile;2-methyl-6-nitrobenzonitrile(SALTDATA: FREE);2-Methyl-6-nitrobenzonitrile 98%;5-(4-methoxyphenyl)-2,4-dioxo-1-imidazolidinecarboxylic acid ethyl ester;2-Methyl-6-nitrobenzonitrile> | | CAS: | 1885-76-3 | | MF: | C8H6N2O2 | | MW: | 162.15 | | EINECS: | 217-553-0 | | Product Categories: | | | Mol File: | 1885-76-3.mol |  |
| | 2-METHYL-6-NITROBENZONITRILE Chemical Properties |
| Melting point | 108-110 °C (lit.) | | Boiling point | 326.2±30.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | 1S/C8H6N2O2/c1-6-3-2-4-8(10(11)12)7(6)5-9/h2-4H,1H3 | | InChIKey | BOTPDHNZLRJZOO-UHFFFAOYSA-N | | SMILES | Cc1cccc(c1C#N)[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-METHYL-6-NITROBENZONITRILE Usage And Synthesis |
| Uses | 2-Methyl-6-nitrobenzonitrile was used in the synthesis of 5-arylthiomethyl-2,4-diaminoquinazolines. It was also used as starting reagent in the microwave assisted synthesis of 8-amino-2-methyl-3,4-dihydroisoquinolin-1-one. |
| | 2-METHYL-6-NITROBENZONITRILE Preparation Products And Raw materials |
|