| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- T56-LIMKi
-
- $40.00
-
2026-08-04
- CAS:924473-59-6
- Purity: 99.57%
- Supply Ability: 10g
|
| | T5601640 Basic information |
| Product Name: | T5601640 | | Synonyms: | T5601640;T56-LIMKi;3-methyl-N-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]-1,2-oxazole-5-carboxamide;T-5601640(T56-LIMKi);3-Methyl-N-[3-[[[3-(trifluoromethyl)phenyl]amino]carbonyl]phenyl]-5-isoxazolecarboxamide;T5601640;T 5601640;T56-LIMKI;T56-LIMKi - T5601640;5-Isoxazolecarboxamide, 3-methyl-N-[3-[[[3-(trifluoromethyl)phenyl]amino]carbonyl]phenyl]- | | CAS: | 924473-59-6 | | MF: | C19H14F3N3O3 | | MW: | 389.33 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 924473-59-6.mol |  |
| | T5601640 Chemical Properties |
| Boiling point | 403.4±45.0 °C(Predicted) | | density | 1.426±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml; DMF:PBS(pH7.2) (1:2): 0.33 mg/ml; DMSO: 20 mg/ml | | form | powder | | pka | 11.41±0.70(Predicted) | | color | white to beige | | InChI | 1S/C19H14F3N3O3/c1-11-8-16(28-25-11)18(27)24-14-6-2-4-12(9-14)17(26)23-15-7-3-5-13(10-15)19(20,21)22/h2-10H,1H3,(H,23,26)(H,24,27) | | InChIKey | XVOKFRPKSAWELK-UHFFFAOYSA-N | | SMILES | O=C(NC1=CC(C(F)(F)F)=CC=C1)C2=CC(NC(C3=CC(C)=NO3)=O)=CC=C2 |
| RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Chronic 4 |
| | T5601640 Usage And Synthesis |
| Uses | T 5601640 is a LIMK inhibitor and is used for the treatment of proliferative disorders such as cancer, neurofibromatosis and neuronal differentiation associated disaeses. | | Biochem/physiol Actions | T56-LIMKi is a LIMK2 inhibitor that reduces phosphorylated cofilin, and induces disassembly of actin stress fibers in NF1-/- MEFs cells. | | in vivo | T56-LIMKi can induce inhibition of cofilin phosphorylation and Panc-1 tumor shrinkage in vivo. Mice treated with T56-LIMKi (60 mg/kg) shows a significant decrease in tumor volume compared to control[1]. | | IC 50 | LIMK2 | | storage | Store at +4°C |
| | T5601640 Preparation Products And Raw materials |
|