| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-Chlorophenylboronic acid, pinacol ester manufacturers
|
| | 3-Chlorophenylboronic acid, pinacol ester Basic information |
| Product Name: | 3-Chlorophenylboronic acid, pinacol ester | | Synonyms: | 1,3,2-Dioxaborolane, 2-(3-chlorophenyl)-4,4,5,5-tetramethyl-;3-Chlorobenzeneboronic acid pinacol ester;2-(3-Chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;3-Chlorophenylboronic acid, pinacol ester | | CAS: | 635305-47-4 | | MF: | C12H16BClO2 | | MW: | 238.52 | | EINECS: | | | Product Categories: | | | Mol File: | 635305-47-4.mol |  |
| | 3-Chlorophenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 60-70° | | Boiling point | 317.9±25.0 °C(Predicted) | | density | 1.1g/ml | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | Appearance | Colorless to off-white Solid-liquid mixture | | InChI | 1S/C12H16BClO2/c1-11(2)12(3,4)16-13(15-11)9-6-5-7-10(14)8-9/h5-8H,1-4H3 | | InChIKey | CHQKHVZXPNHWEA-UHFFFAOYSA-N | | SMILES | CC1(C)C(C)(C)OB(C2=CC(Cl)=CC=C2)O1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Chlorophenylboronic acid, pinacol ester Usage And Synthesis |
| | 3-Chlorophenylboronic acid, pinacol ester Preparation Products And Raw materials |
| Raw materials | 3-chlorobenzenediazonium tetrafluorborate-->Bis[(pinacolato)boryl]Methane-->boranylbis(propan-2-yl)amine-->1-Chloro-3-iodobenzene-->3-Chlorophenylboronic acid-->3-Bromochlorobenzene-->2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane-->Pinacol-->3-Chloroaniline-->Bis(pinacolato)diboron | | Preparation Products | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)chlorobenzene |
|