|
|
| | 3-Phenylacrylic anhydride Basic information |
| Product Name: | 3-Phenylacrylic anhydride | | Synonyms: | 3-phenyl-2-propenoicacid,anhydride;Cinnamic acid anhydride;cinnamicacidanhydride;NSC 78945;2-Propenoic acid,3-phenyl-, 1,1'-anhydride;Bis(3-phenylpropenoic)anhydride;2-Propenoic acid, 3-phenyl-, anhydride;Ai3-18175 | | CAS: | 538-56-7 | | MF: | C18H14O3 | | MW: | 278.3 | | EINECS: | 208-695-4 | | Product Categories: | | | Mol File: | 538-56-7.mol |  |
| | 3-Phenylacrylic anhydride Chemical Properties |
| Melting point | 138℃ (ethanol ) | | Boiling point | 381.12°C (rough estimate) | | density | 1.1627 (rough estimate) | | refractive index | 1.5490 (estimate) | | InChI | InChI=1S/C18H14O3/c19-17(13-11-15-7-3-1-4-8-15)21-18(20)14-12-16-9-5-2-6-10-16/h1-14H/b13-11+,14-12+ | | InChIKey | FXEDRSGUZBCDMO-PHEQNACWSA-N | | SMILES | C1(=CC=CC=C1)/C=C/C(=O)OC(=O)/C=C/C1C=CC=CC=1 |
| | 3-Phenylacrylic anhydride Usage And Synthesis |
| Uses | Fragrance and flavoring ingredient. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 59, p. 2913, 1994 DOI: 10.1021/jo00089a046 Synthetic Communications, 13, p. 471, 1983 DOI: 10.1080/00397918308081826 | | Purification Methods | Crystallise the anhydride from *C6H6 or toluene/pet ether (b 60-80o) or EtOH (m 135-136o). [Beilstein 9 III 2703, 9 IV 2018.] |
| | 3-Phenylacrylic anhydride Preparation Products And Raw materials |
|