- TBMP
-
- $29.00 / 100mg
-
2026-01-26
- CAS:88-32-4
- Min. Order:
- Purity: 99.42%
- Supply Ability: 10g
|
| | 2-TERT-BUTYL-4-HYDROXYANISOLE Basic information |
| | 2-TERT-BUTYL-4-HYDROXYANISOLE Chemical Properties |
| Melting point | 64℃ | | Boiling point | 253.08°C (rough estimate) | | density | 0.9976 (rough estimate) | | refractive index | 1.4708 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 10.58±0.18(Predicted) | | form | Solid | | color | Off-White to Pale Beige | | Major Application | pharmaceutical small molecule | | InChI | 1S/C11H16O2/c1-11(2,3)9-7-8(12)5-6-10(9)13-4/h5-7,12H,1-4H3 | | InChIKey | IMOYOUMVYICGCA-UHFFFAOYSA-N | | SMILES | O(C)c1c(cc(cc1)O)C(C)(C)C | | EPA Substance Registry System | Phenol, 3-(1,1-dimethylethyl)-4-methoxy- (88-32-4) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2909500000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 |
| | 2-TERT-BUTYL-4-HYDROXYANISOLE Usage And Synthesis |
| Uses | Labelled Phencyclidine analog as anticholinergic agent. | | Uses | 2-tert-Butyl-4-hydroxyanisole shows insecticidal activity. | | Definition | ChEBI: An aromatic ether that is 4-methoxyphenol in which one of the hydrogens ortho- to the methoxy group is replaced by a tert-butyl group. | | Synthesis Reference(s) | Synthesis, p. 638, 1980 DOI: 10.1055/s-1980-29150 |
| | 2-TERT-BUTYL-4-HYDROXYANISOLE Preparation Products And Raw materials |
|