|
|
| | 4-Bromo-2-chlorobenzonitrile Basic information |
| | 4-Bromo-2-chlorobenzonitrile Chemical Properties |
| Melting point | 67-68°C | | Boiling point | 142-143°C 10mm | | density | 1.74±0.1 g/cm3(Predicted) | | Fp | 142-143°C/10mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | BRN | 3240885 | | InChI | InChI=1S/C7H3BrClN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H | | InChIKey | AYQBMZNSJPVADT-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(Br)C=C1Cl | | LogP | 3.14 | | CAS DataBase Reference | 154607-01-9(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 4-Bromo-2-chlorobenzonitrile Usage And Synthesis |
| Chemical Properties | off-white crystalline | | Uses |
4-Bromo-2-chlorobenzonitrile is used as a intermediate in organic synthesis and a ligand in transition metal complexes.
| | Synthesis | 4-Bromo-2-chlorobenzonitrile is prepared by a two-step reaction of reacting 4-bromo-2-chlorobenzaldehyde and sodium cyanide in aqueous solution. | | References | [1] Medicinal Chemistry Research, 2016, vol. 25, # 4, p. 539 - 552 |
| | 4-Bromo-2-chlorobenzonitrile Preparation Products And Raw materials |
|