|
|
| | 2,3-O-Isopropylidene-L-lyxono-1,4-lactone Basic information |
| Product Name: | 2,3-O-Isopropylidene-L-lyxono-1,4-lactone | | Synonyms: | 2,3-Di-O-isopropylidene-L-lyxonolactone;2,3-ISOPROPYLIDENE-L-LYXONO LACTONE;L-(2-3-ISOPROPYLIDENE)-LYXONO-1,4-LACTONE;2,3-O-Isopropylidene-L-lyxonicacid-1,4-lactone;2,3-ISOPROPYLLIDENE-L-LYXONOLACTONE;2,3-O-(1-Methylethylidene)-L-lyxonic Acid γ-Lactone;2,3-O-Isopropylidene-L-lyxonolactone;2,3-O-ISOPROPYLIDENE-L-LYXONO-1,4-LACTONE USP/EP/BP | | CAS: | 152006-17-2 | | MF: | C8H12O5 | | MW: | 188.18 | | EINECS: | | | Product Categories: | Inhibitors;13C & 2H Sugars;Carbohydrates & Derivatives | | Mol File: | 152006-17-2.mol |  |
| | 2,3-O-Isopropylidene-L-lyxono-1,4-lactone Chemical Properties |
| Melting point | 95-97°C | | Boiling point | 338.1±37.0 °C(Predicted) | | density | 1.258±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Acetone (Sparingly), Chloroform (Slightly) | | form | Solid | | pka | 13.68±0.10(Predicted) | | color | White to Pale Beige | | InChI | InChI=1/C8H12O5/c1-8(2)12-5-4(3-9)11-7(10)6(5)13-8/h4-6,9H,3H2,1-2H3/t4-,5+,6+/s3 | | InChIKey | NHHKFJCWLPPNCN-FLEGHBDQNA-N | | SMILES | [C@]12([H])OC(C)(C)O[C@@]1([H])C(O[C@H]2CO)=O |&1:0,7,11,r| |
| | 2,3-O-Isopropylidene-L-lyxono-1,4-lactone Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2,3-O-(1-Methylethylidene)-L-lyxonic acid γ-lactone is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1]. | | References | [1] Varki A, et al editors. Essentials of Glycobiology [Internet]. 4th ed. Cold Spring Harbor (NY): Cold Spring Harbor Laboratory Press; 2022. PMID:35536922 |
| | 2,3-O-Isopropylidene-L-lyxono-1,4-lactone Preparation Products And Raw materials |
|