|
|
| | 4-HYDROXYMETHYL-1,3-DIOXOLAN-2-ONE Basic information |
| | 4-HYDROXYMETHYL-1,3-DIOXOLAN-2-ONE Chemical Properties |
| Boiling point | 137-140 °C/0.5 mmHg (lit.) | | density | 1.4 g/mL at 25 °C (lit.) | | vapor pressure | 0.93Pa at 25℃ | | refractive index | n20/D 1.469(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in water | | form | Liquid | | pka | 13.71±0.10(Predicted) | | color | Clear colorless to pale yellow | | Water Solubility | 1000g/L at 24℃ | | Cosmetics Ingredients Functions | SOLVENT | | InChI | InChI=1S/C4H6O4/c5-1-3-2-7-4(6)8-3/h3,5H,1-2H2 | | InChIKey | JFMGYULNQJPJCY-UHFFFAOYSA-N | | SMILES | O1CC(CO)OC1=O | | LogP | -1.39 at 25℃ | | EPA Substance Registry System | 1,3-Dioxolan-2-one, 4-(hydroxymethyl)- (931-40-8) |
| Safety Statements | 23 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29329990 | | Storage Class | 10 - Combustible liquids |
| | 4-HYDROXYMETHYL-1,3-DIOXOLAN-2-ONE Usage And Synthesis |
| Uses | 4-(Hydroxymethyl)-1,3-dioxolan-2-one is used in method of finishing a metallic surface. | | Preparation | A stirred mixture of potassium hydrogen carbonate (10.0 g, 0.1 mol), 18-crown-6 (0.2 g, 0.76 mmol), and 1-chloro-2,3-epoxypropane (27.6 g, 0.3 mol) was heated at 80℃ for 36 h. After cooling and removal of the potassium salt by filtration, the organic layer was washed with water and 991 was distilled at 152–160℃/0.6–0.8 mmHg; yield 4.83 g (41%). | | Flammability and Explosibility | Non flammable |
| | 4-HYDROXYMETHYL-1,3-DIOXOLAN-2-ONE Preparation Products And Raw materials |
|