|
| Acetoxypropyltrimethoxysilane Basic information |
Product Name: | Acetoxypropyltrimethoxysilane | Synonyms: | 3-Acetoxypropyltrimethoxysilane;Acetic acid 3-(trimethoxysilyl)propyl ester;3-(Trimethoxysilyl)-1-propanol acetate;ACETOXYPROPYLTRIMETHOXYSILANE;3-(trimethoxysilyl)propyl acetate;1-Propanol, 3-(trimethoxysilyl)-, 1-acetate;Acetoxypropyltrimethoxsilane;DK341 | CAS: | 59004-18-1 | MF: | C8H18O5Si | MW: | 222.31 | EINECS: | 261-552-8 | Product Categories: | | Mol File: | 59004-18-1.mol |  |
| Acetoxypropyltrimethoxysilane Chemical Properties |
Melting point | <0°C | Boiling point | 92 °C | density | 1.062 | refractive index | 1.4146 | Fp | 93°C | storage temp. | 2-8°C | Specific Gravity | 1.062 | Appearance | Colorless to off-white Liquid | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | InChI | InChI=1S/C8H18O5Si/c1-8(9)13-6-5-7-14(10-2,11-3)12-4/h5-7H2,1-4H3 | InChIKey | FZTPAOAMKBXNSH-UHFFFAOYSA-N | SMILES | C(OC(=O)C)CC[Si](OC)(OC)OC |
| Acetoxypropyltrimethoxysilane Usage And Synthesis |
| Acetoxypropyltrimethoxysilane Preparation Products And Raw materials |
|