- 3-(trimethoxysilyl)propyl acetate
-
- $200.00 / 1KG
-
2025-09-25
- CAS:59004-18-1
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-(trimethoxysilyl)propyl acetate Basic information |
| Product Name: | 3-(trimethoxysilyl)propyl acetate | | Synonyms: | 3-Acetoxypropyltrimethoxysilane;Acetic acid 3-(trimethoxysilyl)propyl ester;3-(Trimethoxysilyl)-1-propanol acetate;3-(trimethoxysilyl)propyl acetate;1-Propanol, 3-(trimethoxysilyl)-, 1-acetate;Acetoxypropyltrimethoxsilane;DK341;3-(trimethoxysilyl)-1-Propanol 1-acetate | | CAS: | 59004-18-1 | | MF: | C8H18O5Si | | MW: | 222.31 | | EINECS: | 261-552-8 | | Product Categories: | | | Mol File: | 59004-18-1.mol |  |
| | 3-(trimethoxysilyl)propyl acetate Chemical Properties |
| Melting point | <0°C | | Boiling point | 92 °C | | density | 1.062 | | refractive index | 1.4146 | | Fp | 93°C | | storage temp. | 2-8°C | | Specific Gravity | 1.062 | | Appearance | Colorless to off-white Liquid | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C8H18O5Si/c1-8(9)13-6-5-7-14(10-2,11-3)12-4/h5-7H2,1-4H3 | | InChIKey | FZTPAOAMKBXNSH-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)CC[Si](OC)(OC)OC |
| | 3-(trimethoxysilyl)propyl acetate Usage And Synthesis |
| | 3-(trimethoxysilyl)propyl acetate Preparation Products And Raw materials |
|