|
|
| | 3-(ACRYLOYLOXY)PROPYLTRIMETHOXYSILANE Basic information |
| | 3-(ACRYLOYLOXY)PROPYLTRIMETHOXYSILANE Chemical Properties |
| Boiling point | 68 °C0.4 mm Hg(lit.) | | density | 1.055 g/mL at 25 °C(lit.) | | vapor pressure | 20.5Pa at 25℃ | | refractive index | n20/D 1.429(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | Miscible with organic solvents. | | form | Liquid | | Specific Gravity | 1.0 | | color | Clear colorless | | Water Solubility | 5.8-4300mg/L at 20℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Moisture Sensitive | | BRN | 2046320 | | Cosmetics Ingredients Functions | SOLVENT | | InChI | 1S/C9H18O5Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4/h5H,1,6-8H2,2-4H3 | | InChIKey | KBQVDAIIQCXKPI-UHFFFAOYSA-N | | SMILES | CO[Si](CCCOC(=O)C=C)(OC)OC | | LogP | 1.6-2.18 at 20-23℃ | | CAS DataBase Reference | 4369-14-6(CAS DataBase Reference) | | EPA Substance Registry System | 2-Propenoic acid, 3-(trimethoxysilyl)propyl ester (4369-14-6) |
| Hazard Codes | Xi,C | | Risk Statements | 37/38-41-52/53-43-37-34-20 | | Safety Statements | 26-39-61-45-36/37/39 | | RIDADR | UN1760 | | WGK Germany | 3 | | RTECS | UD3810000 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
| | 3-(ACRYLOYLOXY)PROPYLTRIMETHOXYSILANE Usage And Synthesis |
| Chemical Properties | Colorless transparent liquid | | Uses | 3-(Acryloyloxy)propyltrimethoxysilane is used to enhance the thermal conductivity of silicone rubber filled with hybrid fillers. It is involved in the synthesis of vinyl and acryalte modified silica nanoparticles by using vinyltrimethoxysilane. Further, it is used as a silane coupling agent involved in the modification of fluorescein isothiocyanate-mesoporous silica nanoparticles with carbon-carbon double bonds. | | General Description | 3-(Trimethoxysilyl)propyl acrylate is a reactive monomer that is majorly used as a silane coupling agent for the formation of hybrid compounds. It facilitates the formation of a hydrophobic surface by lowering the surface tension and increasing the wettability. |
| | 3-(ACRYLOYLOXY)PROPYLTRIMETHOXYSILANE Preparation Products And Raw materials |
|