| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-Cyclopentene-1-carboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1,1-dimethylethyl ester Basic information |
| Product Name: | 3-Cyclopentene-1-carboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1,1-dimethylethyl ester | | Synonyms: | TERT-BUTYL 1-(BOC-AMINO)-3-CYCLOPENTENE-1-CARBOXYLATE, 97%;1-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-cyclopentene-1-carboxylic acid 1,1-dimethylethyl ester;tert-butyl1-((tert-butoxycarbonyl)amino)cyclopent-3-ene-1-carboxylate;tert-Butyl 1-(Boc-amino)-3-cyclopentene-1-carboxylate;3-Cyclopentene-1-carboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1,1-dimethylethyl ester | | CAS: | 521964-59-0 | | MF: | C15H25NO4 | | MW: | 283.36 | | EINECS: | | | Product Categories: | | | Mol File: | 521964-59-0.mol | ![3-Cyclopentene-1-carboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1,1-dimethylethyl ester Structure](CAS/GIF/521964-59-0.gif) |
| | 3-Cyclopentene-1-carboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1,1-dimethylethyl ester Chemical Properties |
| Melting point | 86-90 °C | | Boiling point | 362.3±41.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | pka | 9.49±0.20(Predicted) | | form | solid | | InChI | 1S/C15H25NO4/c1-13(2,3)19-11(17)15(9-7-8-10-15)16-12(18)20-14(4,5)6/h7-8H,9-10H2,1-6H3,(H,16,18) | | InChIKey | CDPAAIMSAXXWQH-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NC1(CC=CC1)C(=O)OC(C)(C)C |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 3-Cyclopentene-1-carboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1,1-dimethylethyl ester Usage And Synthesis |
| | 3-Cyclopentene-1-carboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|